CAS 1255574-68-5 is the registry number for 8-Bromo-6-methylquinoline hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
8-bromo-6-methylquinoline;hydrochloride (CAS 1255574-68-5) is a chemical compound with the molecular formula C10H9BrClN and a molecular weight of 258.54 g/mol. IUPAC name: 8-bromo-6-methylquinoline;hydrochloride. InChIKey: XIBMEDNZAUEGDZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClN |
|---|---|
| Molecular weight | 258.54 g/mol |
| IUPAC name | 8-bromo-6-methylquinoline;hydrochloride |
| InChIKey | XIBMEDNZAUEGDZ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)Br)N=CC=C2.Cl |
Computed by PubChem (NCBI)