cas: 71590-31-3 — see every product listed under this CAS number, including other names
6-Bromonaphthalen-2-amine hydrochloride, 97%, 97% (CAS 71590-31-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FFBZ-10g |
| cas | 71590-31-3 |
| size | 10g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 309.20 Pln | |
| Chemat | 100g | 2142.80 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 25g | 654.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromonaphthalen-2-amine;hydrochloride (CAS 71590-31-3) is a chemical compound with the molecular formula C10H9BrClN and a molecular weight of 258.54 g/mol. IUPAC name: 6-bromonaphthalen-2-amine;hydrochloride. InChIKey: PIUVTVGJKFGBJL-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClN |
|---|---|
| Molecular weight | 258.54 g/mol |
| IUPAC name | 6-bromonaphthalen-2-amine;hydrochloride |
| InChIKey | PIUVTVGJKFGBJL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1N.Cl |
Computed by PubChem (NCBI)