CAS 2377035-12-4 is the registry number for 5-Bromonaphthalen-2-amine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
5-bromonaphthalen-2-amine;hydrochloride (CAS 2377035-12-4) is a chemical compound with the molecular formula C10H9BrClN and a molecular weight of 258.54 g/mol. IUPAC name: 5-bromonaphthalen-2-amine;hydrochloride. InChIKey: YHOJWPKBPIRZJB-UHFFFAOYSA-N.
| Molecular formula | C10H9BrClN |
|---|---|
| Molecular weight | 258.54 g/mol |
| IUPAC name | 5-bromonaphthalen-2-amine;hydrochloride |
| InChIKey | YHOJWPKBPIRZJB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)N)C(=C1)Br.Cl |
Computed by PubChem (NCBI)