cas: 912773-22-9 — see every product listed under this CAS number, including other names
6-Bromopyrazolo[1,5-a]pyrimidine-3-carboxylic acid 95% (CAS 912773-22-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A553569-1g |
| cas | 912773-22-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1616.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A553569 |
6-bromopyrazolo[1,5-a]pyrimidine-3-carboxylic acid (CAS 912773-22-9) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 6-bromopyrazolo[1,5-a]pyrimidine-3-carboxylic acid. InChIKey: OKAAFIKHHROVHN-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 6-bromopyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| InChIKey | OKAAFIKHHROVHN-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C(C=NN21)C(=O)O)Br |
Computed by PubChem (NCBI)