CAS 909776-51-8 appears in our catalog under these names: 2-Bromo-6-nitro-1h-benzo[d]imidazole, 95%, 2–Bromo–6–nitro–1H–benzo(d)imidazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-bromo-6-nitro-1H-benzimidazole (CAS 909776-51-8) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 2-bromo-6-nitro-1H-benzimidazole. InChIKey: AZDRFCMMCKMEMX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 2-bromo-6-nitro-1H-benzimidazole |
| InChIKey | AZDRFCMMCKMEMX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC(=N2)Br |
Computed by PubChem (NCBI)