CAS 1031927-16-8 appears in our catalog under these names: 6-Bromo-8-nitroimidazo[1,2-a]pyridine, 95%, 6-Bromo-8-nitroimidazo(1,2-a)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
6-bromo-8-nitroimidazo[1,2-a]pyridine (CAS 1031927-16-8) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 6-bromo-8-nitroimidazo[1,2-a]pyridine. InChIKey: VJQWZCOWPZAAFG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 6-bromo-8-nitroimidazo[1,2-a]pyridine |
| InChIKey | VJQWZCOWPZAAFG-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)