cas: 886371-20-6 — see every product listed under this CAS number, including other names
6-Bromopyridine-3-sulfonyl chloride 95% (CAS 886371-20-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A491336-100mg |
| cas | 886371-20-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 748.62 Pln | |
| Ambeed | 250mg | 1377.19 Pln | |
| Ambeed | 1g | 3346.31 Pln | |
| Ambeed | 5g | 9915.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A491336 |
6-bromopyridine-3-sulfonyl chloride (CAS 886371-20-6) is a chemical compound with the molecular formula C5H3BrClNO2S and a molecular weight of 256.51 g/mol. IUPAC name: 6-bromopyridine-3-sulfonyl chloride. InChIKey: ILKASQDZWIHVOO-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClNO2S |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 6-bromopyridine-3-sulfonyl chloride |
| InChIKey | ILKASQDZWIHVOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)