Products 886371-20-6

CAS 886371-20-6 appears in our catalog under these names: 6–Bromopyridine–3–sulfonyl chloride, 6-Bromopyridine-3-sulfonyl chloride, 95%, 6-Bromopyridine-3-sulfonyl chloride 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg.

Structural formula: {0} (CAS {1})

6-bromopyridine-3-sulfonyl chloride (CAS 886371-20-6) is a chemical compound with the molecular formula C5H3BrClNO2S and a molecular weight of 256.51 g/mol. IUPAC name: 6-bromopyridine-3-sulfonyl chloride. InChIKey: ILKASQDZWIHVOO-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3BrClNO2S
Molecular weight256.51 g/mol
IUPAC name6-bromopyridine-3-sulfonyl chloride
InChIKeyILKASQDZWIHVOO-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)