6-Bromopyridine-3-sulfonyl chloride, 95%
cas: 886371-20-6 — see every product listed under this CAS number, including other names
6-Bromopyridine-3-sulfonyl chloride, 95% (CAS 886371-20-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg, 5g. Offered by: Combi-blocks, Fluorochem, Ambeed, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | JD-4370-1g |
| cas | 886371-20-6 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 100mg | 893.45 Pln | |
| Fluorochem | 250mg | 1684.84 Pln | |
| Fluorochem | 500mg | 2825.06 Pln | |
| Fluorochem | 1g | 5355.42 Pln | |
| Fluorochem | 5g | 15586.20 Pln | |
| Ambeed | 100mg | 759.75 Pln | |
| Ambeed | 250mg | 1393.88 Pln | |
| Ambeed | 1g | 3379.69 Pln | |
| Ambeed | 5g | 10015.75 Pln | |
| BLDpharm | 100mg | 814.18 Pln | |
| BLDpharm | 250mg | 1497.28 Pln | |
| BLDpharm | 1g | 3635.41 Pln | |
| BLDpharm | 5g | 10799.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
6-bromopyridine-3-sulfonyl chloride (CAS 886371-20-6) is a chemical compound with the molecular formula C5H3BrClNO2S and a molecular weight of 256.51 g/mol. IUPAC name: 6-bromopyridine-3-sulfonyl chloride. InChIKey: ILKASQDZWIHVOO-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClNO2S |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 6-bromopyridine-3-sulfonyl chloride |
| InChIKey | ILKASQDZWIHVOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)