cas: 57339-57-8 — see every product listed under this CAS number, including other names
6-Bromoquinolin-8-amine, 95%, 95% (CAS 57339-57-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EI9Y-100mg |
| cas | 57339-57-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 520.40 Pln | |
| Chemat | 5g | 2061.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromoquinolin-8-amine (CAS 57339-57-8) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 6-bromoquinolin-8-amine. InChIKey: MFCPXRHDOOYWNO-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 6-bromoquinolin-8-amine |
| InChIKey | MFCPXRHDOOYWNO-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)N)Br |
Computed by PubChem (NCBI)