cas: 957066-11-4 — see every product listed under this CAS number, including other names
6-Chloro-1-methylindole-2-boronic acid 96% (CAS 957066-11-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A707293-100mg |
| cas | 957066-11-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2211.56 Pln | |
| Ambeed | 5g | 8636.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A707293 |
(6-chloro-1-methylindol-2-yl)boronic acid (CAS 957066-11-4) is a chemical compound with the molecular formula C9H9BClNO2 and a molecular weight of 209.44 g/mol. IUPAC name: (6-chloro-1-methylindol-2-yl)boronic acid. InChIKey: HAKQDXBWDPGHDD-UHFFFAOYSA-N.
| Molecular formula | C9H9BClNO2 |
|---|---|
| Molecular weight | 209.44 g/mol |
| IUPAC name | (6-chloro-1-methylindol-2-yl)boronic acid |
| InChIKey | HAKQDXBWDPGHDD-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C)C=C(C=C2)Cl)(O)O |
Computed by PubChem (NCBI)