CAS 850568-71-7 appears in our catalog under these names: Quinoline-3-boronic acid hydrochloride, 96%, Quinolin-3-ylboronic acid hydrochloride, 98%, Quinoline-3-boronic acid, HCl, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 25g, 100g, 1g.
Quinolin-3-ylboronic acid;hydrochloride (CAS 850568-71-7) is a chemical compound with the molecular formula C9H9BClNO2 and a molecular weight of 209.44 g/mol. IUPAC name: quinolin-3-ylboronic acid;hydrochloride. InChIKey: BQFQABXCFQWPGH-UHFFFAOYSA-N.
| Molecular formula | C9H9BClNO2 |
|---|---|
| Molecular weight | 209.44 g/mol |
| IUPAC name | quinolin-3-ylboronic acid;hydrochloride |
| InChIKey | BQFQABXCFQWPGH-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2N=C1)(O)O.Cl |
Computed by PubChem (NCBI)