CAS 1236031-63-2 appears in our catalog under these names: Isoquinolin-6-ylboronic acid hydrochloride, 95%, Isoquinolin-6-ylboronic acid hydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 10g, 250mg.
Isoquinolin-6-ylboronic acid;hydrochloride (CAS 1236031-63-2) is a chemical compound with the molecular formula C9H9BClNO2 and a molecular weight of 209.44 g/mol. IUPAC name: isoquinolin-6-ylboronic acid;hydrochloride. InChIKey: MKNBRFWRIQVMGU-UHFFFAOYSA-N.
| Molecular formula | C9H9BClNO2 |
|---|---|
| Molecular weight | 209.44 g/mol |
| IUPAC name | isoquinolin-6-ylboronic acid;hydrochloride |
| InChIKey | MKNBRFWRIQVMGU-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=NC=C2)(O)O.Cl |
Computed by PubChem (NCBI)