6-Chloro-2-(trifluoromethyl)-1H-indole, 95%
cas: 934843-27-3 — see every product listed under this CAS number, including other names
6-Chloro-2-(trifluoromethyl)-1H-indole, 95% (CAS 934843-27-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25mg, 50mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F432147-100MG |
| cas | 934843-27-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 1325.59 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 1410.56 Pln | |
| Chemat | 25mg | 155.60 Pln | |
| Chemat | 50mg | 184.40 Pln | |
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1523.60 Pln | |
| BLDpharm | 50mg | 192.18 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 403.22 Pln | |
| BLDpharm | 1g | 1380.65 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
6-chloro-2-(trifluoromethyl)-1H-indole (CAS 934843-27-3) is a chemical compound with the molecular formula C9H5ClF3N and a molecular weight of 219.59 g/mol. IUPAC name: 6-chloro-2-(trifluoromethyl)-1H-indole. InChIKey: LCZVFFOPDIBUMF-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF3N |
|---|---|
| Molecular weight | 219.59 g/mol |
| IUPAC name | 6-chloro-2-(trifluoromethyl)-1H-indole |
| InChIKey | LCZVFFOPDIBUMF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)