Products 633317-69-8
CAS 633317-69-8 appears in our catalog under these names: 2-Chloro-6-(trifluoromethyl)phenylacetonitrile, 95%, 2-Chloro-6-(trifluoromethyl)phenylacetonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 2,5g.
2-[2-chloro-6-(trifluoromethyl)phenyl]acetonitrile (CAS 633317-69-8) is a chemical compound with the molecular formula C9H5ClF3N and a molecular weight of 219.59 g/mol. IUPAC name: 2-[2-chloro-6-(trifluoromethyl)phenyl]acetonitrile. InChIKey: MJCPWXFGJWYXER-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF3N |
|---|---|
| Molecular weight | 219.59 g/mol |
| IUPAC name | 2-[2-chloro-6-(trifluoromethyl)phenyl]acetonitrile |
| InChIKey | MJCPWXFGJWYXER-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC#N)C(F)(F)F |
Computed by PubChem (NCBI)