CAS 934843-27-3 appears in our catalog under these names: 6–Chloro–2–(trifluoromethyl)–1H–indole, 6-Chloro-2-(trifluoromethyl)-1H-indole, 95%, 95%, 6-Chloro-2-(trifluoromethyl)-1H-indole, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
6-chloro-2-(trifluoromethyl)-1H-indole (CAS 934843-27-3) is a chemical compound with the molecular formula C9H5ClF3N and a molecular weight of 219.59 g/mol. IUPAC name: 6-chloro-2-(trifluoromethyl)-1H-indole. InChIKey: LCZVFFOPDIBUMF-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF3N |
|---|---|
| Molecular weight | 219.59 g/mol |
| IUPAC name | 6-chloro-2-(trifluoromethyl)-1H-indole |
| InChIKey | LCZVFFOPDIBUMF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)