cas: 1094323-19-9 — see every product listed under this CAS number, including other names
6-Chloro-2-ethoxy-3-nitropyridine, 95%, 95% (CAS 1094323-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1105ME-100mg |
| cas | 1094323-19-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 779.60 Pln | |
| Chemat | 1g | 1979.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2-ethoxy-3-nitropyridine (CAS 1094323-19-9) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: 6-chloro-2-ethoxy-3-nitropyridine. InChIKey: XJUSTFBLMBHYOD-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 6-chloro-2-ethoxy-3-nitropyridine |
| InChIKey | XJUSTFBLMBHYOD-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)