cas: 1156390-49-6 — see every product listed under this CAS number, including other names
6-Chloro-2-oxoindoline-5-carboxylic acid 97% (CAS 1156390-49-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A212508-50mg |
| cas | 1156390-49-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 203.50 Pln | |
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 932.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A212508 |
6-chloro-2-oxo-1,3-dihydroindole-5-carboxylic acid (CAS 1156390-49-6) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 6-chloro-2-oxo-1,3-dihydroindole-5-carboxylic acid. InChIKey: GALGGHJFGWMWCN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 6-chloro-2-oxo-1,3-dihydroindole-5-carboxylic acid |
| InChIKey | GALGGHJFGWMWCN-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC1=O)Cl)C(=O)O |
Computed by PubChem (NCBI)