cas: 1156390-49-6 — see every product listed under this CAS number, including other names
6-Chloro-2-oxoindoline-5-carboxylic acid, 97%, 97% (CAS 1156390-49-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119Z56-50mg |
| cas | 1156390-49-6 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 155.60 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 678.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2-oxo-1,3-dihydroindole-5-carboxylic acid (CAS 1156390-49-6) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 6-chloro-2-oxo-1,3-dihydroindole-5-carboxylic acid. InChIKey: GALGGHJFGWMWCN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 6-chloro-2-oxo-1,3-dihydroindole-5-carboxylic acid |
| InChIKey | GALGGHJFGWMWCN-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC1=O)Cl)C(=O)O |
Computed by PubChem (NCBI)