cas: 259793-90-3 — see every product listed under this CAS number, including other names
6-Chloro-3-hydroxypyrazine-2-carboxamide 95% (CAS 259793-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A122172-100mg |
| cas | 259793-90-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 1004.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A122172 |
5-chloro-2-oxo-1H-pyrazine-3-carboxamide (CAS 259793-90-3) is a chemical compound with the molecular formula C5H4ClN3O2 and a molecular weight of 173.56 g/mol. IUPAC name: 5-chloro-2-oxo-1H-pyrazine-3-carboxamide. InChIKey: XERRFWUVFFKJNT-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O2 |
|---|---|
| Molecular weight | 173.56 g/mol |
| IUPAC name | 5-chloro-2-oxo-1H-pyrazine-3-carboxamide |
| InChIKey | XERRFWUVFFKJNT-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=O)N1)C(=O)N)Cl |
Computed by PubChem (NCBI)