cas: 259793-90-3 — see every product listed under this CAS number, including other names
6-Chloro-3-hydroxypyrazine-2-carboxamide, 96% (CAS 259793-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F323906-100MG |
| cas | 259793-90-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 971.55 Pln | |
| Fluorochem | 5g | 3345.71 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-2-oxo-1H-pyrazine-3-carboxamide (CAS 259793-90-3) is a chemical compound with the molecular formula C5H4ClN3O2 and a molecular weight of 173.56 g/mol. IUPAC name: 5-chloro-2-oxo-1H-pyrazine-3-carboxamide. InChIKey: XERRFWUVFFKJNT-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O2 |
|---|---|
| Molecular weight | 173.56 g/mol |
| IUPAC name | 5-chloro-2-oxo-1H-pyrazine-3-carboxamide |
| InChIKey | XERRFWUVFFKJNT-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=O)N1)C(=O)N)Cl |
Computed by PubChem (NCBI)