CAS 136901-10-5 is the registry number for 6-chloro-3-nitropyridin-2-amine, 98%, 98%. Offered by: Chemat. Available pack sizes: 5g, 25g.
6-chloro-3-nitropyridin-2-amine (CAS 136901-10-5) is a chemical compound with the molecular formula C5H4ClN3O2 and a molecular weight of 173.56 g/mol. IUPAC name: 6-chloro-3-nitropyridin-2-amine. InChIKey: WERABQRUGJIMKQ-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN3O2 |
|---|---|
| Molecular weight | 173.56 g/mol |
| IUPAC name | 6-chloro-3-nitropyridin-2-amine |
| InChIKey | WERABQRUGJIMKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])N)Cl |
Computed by PubChem (NCBI)