cas: 14123-76-3 — see every product listed under this CAS number, including other names
6-Chloro-3-methylisoquinoline, 98% (CAS 14123-76-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233800-250MG |
| cas | 14123-76-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1762.94 Pln | |
| Fluorochem | 10g | 3350.92 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
6-chloro-3-methylisoquinoline (CAS 14123-76-3) is a chemical compound with the molecular formula C10H8ClN and a molecular weight of 177.63 g/mol. IUPAC name: 6-chloro-3-methylisoquinoline. InChIKey: VLPNHJHAQSABQP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | 6-chloro-3-methylisoquinoline |
| InChIKey | VLPNHJHAQSABQP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)Cl)C=N1 |
Computed by PubChem (NCBI)