CAS 4965-33-7 appears in our catalog under these names: 7–Chloroquinaldine, 7-Chloroquinaldine, 7-Chloroquinaldine, 98%, 7-Chloroquinaldine, >95% (HPLC), 7-Chloroquinaldine, >98.0%(GC). Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, TRC. Available pack sizes: 100g, 500g, 50g, 250g, 1000g, 25g, 5g, 1g.
7-chloro-2-methylquinoline (CAS 4965-33-7) is a chemical compound with the molecular formula C10H8ClN and a molecular weight of 177.63 g/mol. IUPAC name: 7-chloro-2-methylquinoline. InChIKey: WQZQFYRSYLXBGP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | 7-chloro-2-methylquinoline |
| InChIKey | WQZQFYRSYLXBGP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)