Products 92-46-6
CAS 92-46-6 appears in our catalog under these names: 6-Chloroquinaldine, 98%, 6–Chloro–2–methylquinoline, 6-Chloro-2-methylquinoline, 98%, 6-Chloro-2-methylquinoline/ 98%, 6-Chloro-2-methylquinoline 99%. Offered by: Fluorochem, GLPBio, Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
6-chloro-2-methylquinoline (CAS 92-46-6) is a chemical compound with the molecular formula C10H8ClN and a molecular weight of 177.63 g/mol. IUPAC name: 6-chloro-2-methylquinoline. InChIKey: OCCIBGIEIBQGAJ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | 6-chloro-2-methylquinoline |
| InChIKey | OCCIBGIEIBQGAJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)