cas: 1558927-43-7 — see every product listed under this CAS number, including other names
6-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine 95% (CAS 1558927-43-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A386207-50mg |
| cas | 1558927-43-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 553.94 Pln | |
| Ambeed | 100mg | 731.94 Pln | |
| Ambeed | 250mg | 1171.38 Pln | |
| Ambeed | 1g | 2634.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A386207 |
6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 1558927-43-7) is a chemical compound with the molecular formula C11H16BClN2O2 and a molecular weight of 254.52 g/mol. IUPAC name: 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: QCBXUQGLZCPEFA-UHFFFAOYSA-N.
| Molecular formula | C11H16BClN2O2 |
|---|---|
| Molecular weight | 254.52 g/mol |
| IUPAC name | 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | QCBXUQGLZCPEFA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)Cl)N |
Computed by PubChem (NCBI)