cas: 1260013-97-5 — see every product listed under this CAS number, including other names
6-Chloro-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-one, 98%, 98% (CAS 1260013-97-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KK2B-100mg |
| cas | 1260013-97-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 2219.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-chloro-5-fluoro-3,4-dihydro-2H-naphthalen-1-one (CAS 1260013-97-5) is a chemical compound with the molecular formula C10H8ClFO and a molecular weight of 198.62 g/mol. IUPAC name: 6-chloro-5-fluoro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: ILVMVVAGVQNEJJ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO |
|---|---|
| Molecular weight | 198.62 g/mol |
| IUPAC name | 6-chloro-5-fluoro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | ILVMVVAGVQNEJJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2F)Cl)C(=O)C1 |
Computed by PubChem (NCBI)