Products 1176030-00-4
CAS 1176030-00-4 is the registry number for 1-(4-Fluorophenyl)cyclopropane-1-carbonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-(4-fluorophenyl)cyclopropane-1-carbonyl chloride (CAS 1176030-00-4) is a chemical compound with the molecular formula C10H8ClFO and a molecular weight of 198.62 g/mol. IUPAC name: 1-(4-fluorophenyl)cyclopropane-1-carbonyl chloride. InChIKey: WIRGIPDZVAHMGC-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO |
|---|---|
| Molecular weight | 198.62 g/mol |
| IUPAC name | 1-(4-fluorophenyl)cyclopropane-1-carbonyl chloride |
| InChIKey | WIRGIPDZVAHMGC-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)F)C(=O)Cl |
Computed by PubChem (NCBI)