Products 1017391-66-0
CAS 1017391-66-0 is the registry number for 1-(2-Fluorophenyl)-cyclopropanecarboxylic acid, methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(2-fluorophenyl)cyclopropane-1-carbonyl chloride (CAS 1017391-66-0) is a chemical compound with the molecular formula C10H8ClFO and a molecular weight of 198.62 g/mol. IUPAC name: 1-(2-fluorophenyl)cyclopropane-1-carbonyl chloride. InChIKey: ZBAMRKNKCLNXKB-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO |
|---|---|
| Molecular weight | 198.62 g/mol |
| IUPAC name | 1-(2-fluorophenyl)cyclopropane-1-carbonyl chloride |
| InChIKey | ZBAMRKNKCLNXKB-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC=C2F)C(=O)Cl |
Computed by PubChem (NCBI)