cas: 1973-09-7 — see every product listed under this CAS number, including other names
6-Chloro-N2,N4-diphenyl-1,3,5-triazine-2,4-diamine, 95%, 95% (CAS 1973-09-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APFO-100mg |
| cas | 1973-09-7 |
| size | 100mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 443.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine (CAS 1973-09-7) is a chemical compound with the molecular formula C15H12ClN5 and a molecular weight of 297.74 g/mol. IUPAC name: 6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine. InChIKey: AHBSUJXKRKWNBN-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN5 |
|---|---|
| Molecular weight | 297.74 g/mol |
| IUPAC name | 6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
| InChIKey | AHBSUJXKRKWNBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=NC(=N2)Cl)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)