cas: 1973-09-7 — see every product listed under this CAS number, including other names
6-Chloro-N2,N4-diphenyl-1,3,5-triazine-2,4-diamine, 98% (CAS 1973-09-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F720825-1G |
| cas | 1973-09-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 778.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine (CAS 1973-09-7) is a chemical compound with the molecular formula C15H12ClN5 and a molecular weight of 297.74 g/mol. IUPAC name: 6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine. InChIKey: AHBSUJXKRKWNBN-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN5 |
|---|---|
| Molecular weight | 297.74 g/mol |
| IUPAC name | 6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
| InChIKey | AHBSUJXKRKWNBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=NC(=N2)Cl)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)