CAS 1973-09-7 appears in our catalog under these names: 6-Chloro-n,n'-diphenyl-1,3,5-triazine-2,4-diamine, 95%, 6-Chloro-N2,N4-diphenyl-1,3,5-triazine-2,4-diamine, 95%, 95%, 6-Chloro-N2,N4-diphenyl-1,3,5-triazine-2,4-diamine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine (CAS 1973-09-7) is a chemical compound with the molecular formula C15H12ClN5 and a molecular weight of 297.74 g/mol. IUPAC name: 6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine. InChIKey: AHBSUJXKRKWNBN-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN5 |
|---|---|
| Molecular weight | 297.74 g/mol |
| IUPAC name | 6-chloro-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
| InChIKey | AHBSUJXKRKWNBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=NC(=N2)Cl)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)