cas: 174671-43-3 — see every product listed under this CAS number, including other names
6-Chlorobenzo(c)(1,2)oxaborol-1(3H)-ol, 97% (CAS 174671-43-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A450820-10g |
| cas | 174671-43-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 50170.96 Pln | |
| AmBeed | 5g | 29521.24 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-chloro-1-hydroxy-3H-2,1-benzoxaborole (CAS 174671-43-3) is a chemical compound with the molecular formula C7H6BClO2 and a molecular weight of 168.39 g/mol. IUPAC name: 6-chloro-1-hydroxy-3H-2,1-benzoxaborole. InChIKey: YXYTZNCLZVURRW-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO2 |
|---|---|
| Molecular weight | 168.39 g/mol |
| IUPAC name | 6-chloro-1-hydroxy-3H-2,1-benzoxaborole |
| InChIKey | YXYTZNCLZVURRW-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)