CAS 174672-06-1 appears in our catalog under these names: 5-chloro-1,3-dihydro-2,1-benzoxaborol-1-ol, AN2718/ 98.89% (existing batch purity), AN2718, AN2718 98%, 5-Chloro-1,3-dihydro-1-hydroxy-2,1-benzoxaborole, 98%, 98%. Offered by: Biosynth, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 50mg, 0,5g, 5mg, 10mg, 25mg, 100mg, 500mg, 250mg.
5-chloro-1-hydroxy-3H-2,1-benzoxaborole (CAS 174672-06-1) is a chemical compound with the molecular formula C7H6BClO2 and a molecular weight of 168.39 g/mol. IUPAC name: 5-chloro-1-hydroxy-3H-2,1-benzoxaborole. InChIKey: HMAFTPZYFJFEHK-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO2 |
|---|---|
| Molecular weight | 168.39 g/mol |
| IUPAC name | 5-chloro-1-hydroxy-3H-2,1-benzoxaborole |
| InChIKey | HMAFTPZYFJFEHK-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=C(C=C2)Cl)O |
Computed by PubChem (NCBI)