CAS 947162-29-0 appears in our catalog under these names: 4-Chloro-1,3-dihydro-2,1-benzoxaborol-1-ol, 95%, 4-Chloro-1,3-dihydro-2,1-benzoxaborol-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-chloro-1-hydroxy-3H-2,1-benzoxaborole (CAS 947162-29-0) is a chemical compound with the molecular formula C7H6BClO2 and a molecular weight of 168.39 g/mol. IUPAC name: 4-chloro-1-hydroxy-3H-2,1-benzoxaborole. InChIKey: IHDXDFBZHOOZJY-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO2 |
|---|---|
| Molecular weight | 168.39 g/mol |
| IUPAC name | 4-chloro-1-hydroxy-3H-2,1-benzoxaborole |
| InChIKey | IHDXDFBZHOOZJY-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C(=CC=C2)Cl)O |
Computed by PubChem (NCBI)