cas: 70395-75-4 — see every product listed under this CAS number, including other names
6-Chloropyrido[2,3-b]pyrazin-2(1H)-one, 97% (CAS 70395-75-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F335063-100MG |
| cas | 70395-75-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 534.20 Pln | |
| Fluorochem | 500mg | 830.98 Pln | |
| Fluorochem | 1g | 1226.67 Pln | |
| Fluorochem | 5g | 5251.29 Pln | |
| Fluorochem | 10g | 8869.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-chloro-1H-pyrido[2,3-b]pyrazin-2-one (CAS 70395-75-4) is a chemical compound with the molecular formula C7H4ClN3O and a molecular weight of 181.58 g/mol. IUPAC name: 6-chloro-1H-pyrido[2,3-b]pyrazin-2-one. InChIKey: GFJOTUQAVJCFEK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O |
|---|---|
| Molecular weight | 181.58 g/mol |
| IUPAC name | 6-chloro-1H-pyrido[2,3-b]pyrazin-2-one |
| InChIKey | GFJOTUQAVJCFEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC(=O)C=N2)Cl |
Computed by PubChem (NCBI)