CAS 2178079-56-4 is the registry number for 5-Chloropyrido[2,3-d]pyrimidin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3H-pyrido[2,3-d]pyrimidin-4-one (CAS 2178079-56-4) is a chemical compound with the molecular formula C7H4ClN3O and a molecular weight of 181.58 g/mol. IUPAC name: 5-chloro-3H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: XAJHRZDWDLUMIW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O |
|---|---|
| Molecular weight | 181.58 g/mol |
| IUPAC name | 5-chloro-3H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | XAJHRZDWDLUMIW-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1Cl)C(=O)NC=N2 |
Computed by PubChem (NCBI)