CAS 1613289-27-2 is the registry number for 8-Chloropyrido[2,3-b]pyrazin-6-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-5H-pyrido[2,3-b]pyrazin-6-one (CAS 1613289-27-2) is a chemical compound with the molecular formula C7H4ClN3O and a molecular weight of 181.58 g/mol. IUPAC name: 8-chloro-5H-pyrido[2,3-b]pyrazin-6-one. InChIKey: KDSSESOVADKJDY-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O |
|---|---|
| Molecular weight | 181.58 g/mol |
| IUPAC name | 8-chloro-5H-pyrido[2,3-b]pyrazin-6-one |
| InChIKey | KDSSESOVADKJDY-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=CC(=O)N2)Cl |
Computed by PubChem (NCBI)