cas: 7658-08-4 — see every product listed under this CAS number, including other names
6-Deoxy-D-glucose, 98%, 98% (CAS 7658-08-4) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 500mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G46T-10mg |
| cas | 7658-08-4 |
| size | 10mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 232.40 Pln | |
| Chemat | 500mg | 4830.80 Pln | |
| Chemat | 100mg | 1082.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R,4S,5S,6R)-6-methyloxane-2,3,4,5-tetrol (CAS 7658-08-4) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (3R,4S,5S,6R)-6-methyloxane-2,3,4,5-tetrol. InChIKey: SHZGCJCMOBCMKK-GASJEMHNSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (3R,4S,5S,6R)-6-methyloxane-2,3,4,5-tetrol |
| InChIKey | SHZGCJCMOBCMKK-GASJEMHNSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O |
Computed by PubChem (NCBI)