cas: 2096336-22-8 — see every product listed under this CAS number, including other names
6-ETHOXY-2-FLUORO-3-(TRIFLUOROMETHYL)PHENYLBORONIC ACID, 97%, 97% (CAS 2096336-22-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHL6-250mg |
| cas | 2096336-22-8 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 746.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[6-ethoxy-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid (CAS 2096336-22-8) is a chemical compound with the molecular formula C9H9BF4O3 and a molecular weight of 251.97 g/mol. IUPAC name: [6-ethoxy-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: FWJDNBLYKZDOPF-UHFFFAOYSA-N.
| Molecular formula | C9H9BF4O3 |
|---|---|
| Molecular weight | 251.97 g/mol |
| IUPAC name | [6-ethoxy-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | FWJDNBLYKZDOPF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)C(F)(F)F)OCC)(O)O |
Computed by PubChem (NCBI)