CAS 2096332-76-0 appears in our catalog under these names: 5-Ethoxy-2-fluoro-3-(trifluoromethyl)phenylboronic acid, 98%, 5-ETHOXY-2-FLUORO-3-(TRIFLUOROMETHYL)PHENYLBORONIC ACID, 97%, 97%, 5-Ethoxy-2-fluoro-3-(trifluoromethyl)phenylboronic acid, 97%, (5-Ethoxy-2-fluoro-3-(trifluoromethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg.
[5-ethoxy-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid (CAS 2096332-76-0) is a chemical compound with the molecular formula C9H9BF4O3 and a molecular weight of 251.97 g/mol. IUPAC name: [5-ethoxy-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: HLNNKYHTOVDUGK-UHFFFAOYSA-N.
| Molecular formula | C9H9BF4O3 |
|---|---|
| Molecular weight | 251.97 g/mol |
| IUPAC name | [5-ethoxy-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | HLNNKYHTOVDUGK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)C(F)(F)F)OCC)(O)O |
Computed by PubChem (NCBI)