Products 1332648-74-4
CAS 1332648-74-4 appears in our catalog under these names: 5-fluoro-2-[(2,2,2-trifluoroethoxy)methyl]phenylboronic acid, 95%, 5–Fluoro–2–((2，2，2–trifluoroethoxy)Methyl)phenylboronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
[5-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid (CAS 1332648-74-4) is a chemical compound with the molecular formula C9H9BF4O3 and a molecular weight of 251.97 g/mol. IUPAC name: [5-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid. InChIKey: BJWGTAZDHFABBR-UHFFFAOYSA-N.
| Molecular formula | C9H9BF4O3 |
|---|---|
| Molecular weight | 251.97 g/mol |
| IUPAC name | [5-fluoro-2-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid |
| InChIKey | BJWGTAZDHFABBR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)COCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)