cas: 2096335-58-7 — see every product listed under this CAS number, including other names
6-ETHOXY-2-FLUOROPYRIDINE-3-BORONIC ACID, 97%, 97% (CAS 2096335-58-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHDA-250mg |
| cas | 2096335-58-7 |
| size | 250mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 880.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(6-ethoxy-2-fluoro-3-pyridinyl)boronic acid (CAS 2096335-58-7) is a chemical compound with the molecular formula C7H9BFNO3 and a molecular weight of 184.96 g/mol. IUPAC name: (6-ethoxy-2-fluoro-3-pyridinyl)boronic acid. InChIKey: CUORRLJBARCROY-UHFFFAOYSA-N.
| Molecular formula | C7H9BFNO3 |
|---|---|
| Molecular weight | 184.96 g/mol |
| IUPAC name | (6-ethoxy-2-fluoro-3-pyridinyl)boronic acid |
| InChIKey | CUORRLJBARCROY-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OCC)F)(O)O |
Computed by PubChem (NCBI)