CAS 2121513-14-0 appears in our catalog under these names: 2-Fluoro-3-ethoxypyridine-5-boronic acid, 95%, Boronic acid, B-(5-ethoxy-6-fluoro-3-pyridinyl)-, ≥95%, ≥95%, 2-Fluoro-3-ethoxypyridine-5-boronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(5-ethoxy-6-fluoro-3-pyridinyl)boronic acid (CAS 2121513-14-0) is a chemical compound with the molecular formula C7H9BFNO3 and a molecular weight of 184.96 g/mol. IUPAC name: (5-ethoxy-6-fluoro-3-pyridinyl)boronic acid. InChIKey: DYZJVTGMDRHEJB-UHFFFAOYSA-N.
| Molecular formula | C7H9BFNO3 |
|---|---|
| Molecular weight | 184.96 g/mol |
| IUPAC name | (5-ethoxy-6-fluoro-3-pyridinyl)boronic acid |
| InChIKey | DYZJVTGMDRHEJB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)F)OCC)(O)O |
Computed by PubChem (NCBI)