CAS 2096335-58-7 appears in our catalog under these names: 6-Ethoxy-2-fluoropyridine-3-boronic acid, 98%, 6-ETHOXY-2-FLUOROPYRIDINE-3-BORONIC ACID, 97%, 97%, 6-Ethoxy-2-fluoropyridine-3-boronic acid, 97%, (6-Ethoxy-2-fluoropyridin-3-yl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg.
(6-ethoxy-2-fluoro-3-pyridinyl)boronic acid (CAS 2096335-58-7) is a chemical compound with the molecular formula C7H9BFNO3 and a molecular weight of 184.96 g/mol. IUPAC name: (6-ethoxy-2-fluoro-3-pyridinyl)boronic acid. InChIKey: CUORRLJBARCROY-UHFFFAOYSA-N.
| Molecular formula | C7H9BFNO3 |
|---|---|
| Molecular weight | 184.96 g/mol |
| IUPAC name | (6-ethoxy-2-fluoro-3-pyridinyl)boronic acid |
| InChIKey | CUORRLJBARCROY-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OCC)F)(O)O |
Computed by PubChem (NCBI)