cas: 1629-94-3 — see every product listed under this CAS number, including other names
6-Fluoro-2-phenyl-1,3-benzothiazole, 95-<97% (CAS 1629-94-3) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC3660-95-97-2.5g |
| cas | 1629-94-3 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 4576.22 Pln | |
| Hoffman Fine Chemicals | 5g | 7134.60 Pln | |
| Hoffman Fine Chemicals | 10g | 11224.18 Pln | |
| Hoffman Fine Chemicals | 25g | 22146.74 Pln | |
| Hoffman Fine Chemicals | 50g | 37433.22 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
6-fluoro-2-phenyl-1,3-benzothiazole (CAS 1629-94-3) is a chemical compound with the molecular formula C13H8FNS and a molecular weight of 229.27 g/mol. IUPAC name: 6-fluoro-2-phenyl-1,3-benzothiazole. InChIKey: MBDZJNBYKCQZLG-UHFFFAOYSA-N.
| Molecular formula | C13H8FNS |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 6-fluoro-2-phenyl-1,3-benzothiazole |
| InChIKey | MBDZJNBYKCQZLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(S2)C=C(C=C3)F |
Computed by PubChem (NCBI)