cas: 148010-65-5 — see every product listed under this CAS number, including other names
6-Fluoro-3,4-dihydro-1H-quinoxalin-2-one, 97% (CAS 148010-65-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F637790-100MG |
| cas | 148010-65-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 846.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-fluoro-3,4-dihydro-1H-quinoxalin-2-one (CAS 148010-65-5) is a chemical compound with the molecular formula C8H7FN2O and a molecular weight of 166.15 g/mol. IUPAC name: 6-fluoro-3,4-dihydro-1H-quinoxalin-2-one. InChIKey: MAUOZEMZZULUTF-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | 6-fluoro-3,4-dihydro-1H-quinoxalin-2-one |
| InChIKey | MAUOZEMZZULUTF-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(N1)C=C(C=C2)F |
Computed by PubChem (NCBI)