Products 1025469-03-7

CAS 1025469-03-7 is the registry number for 3-Amino-6-fluoro-1,3-dihydro-2h-indol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-amino-6-fluoro-1,3-dihydroindol-2-one (CAS 1025469-03-7) is a chemical compound with the molecular formula C8H7FN2O and a molecular weight of 166.15 g/mol. IUPAC name: 3-amino-6-fluoro-1,3-dihydroindol-2-one. InChIKey: VLZOVMFWVXRIEM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7FN2O
Molecular weight166.15 g/mol
IUPAC name3-amino-6-fluoro-1,3-dihydroindol-2-one
InChIKeyVLZOVMFWVXRIEM-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1F)NC(=O)C2N

Computed by PubChem (NCBI)