CAS 1105604-66-7 is the registry number for 3-Amino-5-fluoro-1,3-dihydro-2h-indol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-amino-5-fluoro-1,3-dihydroindol-2-one (CAS 1105604-66-7) is a chemical compound with the molecular formula C8H7FN2O and a molecular weight of 166.15 g/mol. IUPAC name: 3-amino-5-fluoro-1,3-dihydroindol-2-one. InChIKey: CCHUQLXBDSMRIX-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | 3-amino-5-fluoro-1,3-dihydroindol-2-one |
| InChIKey | CCHUQLXBDSMRIX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(C(=O)N2)N |
Computed by PubChem (NCBI)