cas: 145485-58-1 — see every product listed under this CAS number, including other names
6-Fluoro-4,5-dihydro-1H-benzo[b]azepin-2(3H)-one, 95%, 95% (CAS 145485-58-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112D4K-100mg |
| cas | 145485-58-1 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 904.40 Pln | |
| Chemat | 1g | 1749.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one (CAS 145485-58-1) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 6-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one. InChIKey: OISQPDAXCFWYTC-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 6-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| InChIKey | OISQPDAXCFWYTC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC=C2F)NC(=O)C1 |
Computed by PubChem (NCBI)